L-Valinol
Inhibitors/Agonists
L-Valinol is a chiral alcohol that has gained significant attention in the scientific community due to its potential therapeutic and industrial applications. It is a derivative of the amino acid valine and has a chemical formula of C5H11NO.
103.16 g/mol
103.16 g/mol
Formulation:
103.16 g/mol
Source:
Usage:
L-Valinol
The product is for non-human research only. Not for therapeutic or veterinary use.
Catalog Number: BT-321331
CAS Number: 2026-48-4
Molecular Formula: C5H13NO
Molecular Weight: 103.16 g/mol
Purity: ≥ 97%
Inventory: In Stock
| Size | SKU | Price | |
|---|---|---|---|
| 1g | bt-321331-1g | $311.54 | |
| 5g | bt-321331-5g | $400.46 | |
| 10g | bt-321331-10g | $645.23 | |
| 25g | bt-321331-25g | $1,179.38 | |
| 100g | bt-321331-100g | $4,394.77 | |
| 500g | bt-321331-500g | $20,138.62 |
| CAS Number | 2026-48-4 |
|---|---|
| Product Name | L-Valinol |
| Molecular Formula | C5H13NO |
| Molecular Weight | 103.16 g/mol |
| InChI | InChI=1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/t5-/m1/s1 |
| InChI Key | NWYYWIJOWOLJNR-RXMQYKEDSA-N |
| Isomeric SMILES | CC(C)[C@@H](CO)N |
| IUPAC Name | (2S)-2-amino-3-methylbutan-1-ol |
| Canonical SMILES | CC(C)C(CO)N |
| Description | L-Valinol is a chiral alcohol that has gained significant attention in the scientific community due to its potential therapeutic and industrial applications. It is a derivative of the amino acid valine and has a chemical formula of C5H11NO. |
| Method of Synthesis or Extraction | L-Valinol can be synthesized using various methods, including chemical synthesis, enzymatic synthesis, and microbial synthesis. Chemical synthesis involves the reaction of valine with reducing agents such as sodium borohydride or lithium aluminum hydride. Enzymatic synthesis involves the use of enzymes such as alcohol dehydrogenase to catalyze the reaction between valine and a reducing agent. Microbial synthesis involves the use of microorganisms such as bacteria or fungi to produce L-Valinol. The efficiency and yield of each method vary, with chemical synthesis being the most efficient and microbial synthesis being the least efficient. Environmental and safety considerations should also be taken into account when choosing a method of synthesis or extraction. |
| Chemical Structure and Biological Activity | L-Valinol has a chiral center and exists in two enantiomeric forms, L-Valinol and D-Valinol. L-Valinol has been found to exhibit various biological activities, including antitumor, antiviral, and antibacterial activities. It acts as a chiral auxiliary in asymmetric synthesis and has been used in the synthesis of various chiral compounds. The mechanism of action and biological targets of L-Valinol are not fully understood, but it is believed to interact with various enzymes and receptors in the body. |
| Biological Effects | L-Valinol has been found to have potential therapeutic effects on cell function and signal transduction. It has been shown to inhibit the growth of cancer cells and viruses and to modulate the immune system. However, L-Valinol also has potential toxic effects, and its safety profile needs to be further investigated. The potential therapeutic and toxic effects of L-Valinol should be carefully evaluated before its use in medical research. |
| Applications | L-Valinol has various applications in medical, environmental, and industrial research. In medical research, L-Valinol has been used as a chiral auxiliary in drug development and has shown promising results in clinical trials for the treatment of cancer and viral infections. In environmental research, L-Valinol has been used to study its effects on ecosystems and its role in pollution management. In industrial research, L-Valinol has been used in manufacturing processes to improve product quality and efficiency. Health and safety considerations should be taken into account when using L-Valinol in industrial applications. |
| Future Perspectives and Challenges | The use and study of L-Valinol face several limitations, including its low solubility and stability, and its potential toxicity. Possible solutions and improvements include the development of more efficient and environmentally friendly methods of synthesis or extraction, the identification of new biological targets and mechanisms of action, and the optimization of its therapeutic and industrial applications. Future trends and prospects in the application of L-Valinol in scientific research are promising, but further research is needed to fully understand its potential benefits and risks. Conclusion: L-Valinol is a chiral alcohol with potential therapeutic and industrial applications. Its method of synthesis or extraction, chemical structure, biological activity, biological effects, applications, future perspectives, and challenges have been discussed in this paper. Further research is needed to fully understand the potential benefits and risks of L-Valinol and to optimize its use in scientific research. |
| Other CAS Number | 2026-48-4 |
| Pictograms | Irritant |
| SMILES | CC(C)C(CO)N |
| Synonyms | L-2-Amino-3-methyl-1-butanol; (+)-(S)-Valinol; (+)-2-Amino-3-methyl-1-butanol; (+)-Valinol; (2S)-1-Hydroxy-3-methylbutan-2-amine; (2S)-2-Amino-3-methyl-1-butanol; (2S)-Valinol; (S)-(+)-2-Amino-3-methyl-1-butanol; (S)-(+)-Valinol; (S)-2-Amino-3-methyl |
| PubChem Compound | L-Valinol |
| Last Modified | May 29 2023 |