3-(2-Thienyl)propanoic acid
Solid powder
Inhibitors/Agonists
3-(2-Thienyl)propanoic acid is a chemical compound that belongs to the class of thienylpropanoic acids. It is a white crystalline powder that is soluble in water and organic solvents. This compound has gained significant attention in scientific research due to its potential therapeutic and environmental applications.
156.2 g/mol
156.2 g/mol
Formulation:
156.2 g/mol
Source:
Usage:
3-(2-Thienyl)propanoic acid
The product is for non-human research only. Not for therapeutic or veterinary use.
Catalog Number: BT-314794
CAS Number: 5928-51-8
Molecular Formula: C7H8O2S
Molecular Weight: 156.2 g/mol
Purity: ≥ 97%
Inventory: In Stock
| Size | SKU | Price | |
|---|---|---|---|
| 25g | bt-314794-25g | $9,814.46 | |
| 100mg | bt-314794-100mg | $303.08 | |
| 250mg | bt-314794-250mg | $606.15 | |
| 1g | bt-314794-1g | $1,308.92 | |
| 5g | bt-314794-5g | $3,424.00 | |
| 10g | bt-314794-10g | $5,306.92 |
| CAS Number | 5928-51-8 |
|---|---|
| Product Name | 3-(2-Thienyl)propanoic acid |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.2 g/mol |
| Appearance | Solid powder |
| InChI | InChI=1S/C7H8O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,3-4H2,(H,8,9) |
| InChI Key | MJPVYTKZYZPIQA-UHFFFAOYSA-N |
| IUPAC Name | 3-thiophen-2-ylpropanoic acid |
| Canonical SMILES | C1=CSC(=C1)CCC(=O)O |
| Description | 3-(2-Thienyl)propanoic acid is a chemical compound that belongs to the class of thienylpropanoic acids. It is a white crystalline powder that is soluble in water and organic solvents. This compound has gained significant attention in scientific research due to its potential therapeutic and environmental applications. |
| Method of Synthesis or Extraction | There are several methods of synthesizing 3-(2-Thienyl)propanoic acid. One of the commonly used methods is the reaction of 2-thiophenecarboxylic acid with acetyl chloride in the presence of a catalyst such as aluminum chloride. This method yields a moderate amount of product with a purity of around 70%. Another method involves the reaction of 2-thiophenecarboxylic acid with acetic anhydride in the presence of a catalyst such as sulfuric acid. This method yields a higher amount of product with a purity of around 90%. However, this method is less environmentally friendly due to the use of sulfuric acid. The efficiency and yield of each method depend on the reaction conditions and the purity of the starting materials. |
| Chemical Structure and Biological Activity | The chemical structure of 3-(2-Thienyl)propanoic acid consists of a thienyl ring attached to a propanoic acid moiety. This compound has been shown to exhibit various biological activities, including anti-inflammatory, analgesic, and antipyretic effects. The mechanism of action of 3-(2-Thienyl)propanoic acid involves the inhibition of cyclooxygenase enzymes, which are responsible for the production of prostaglandins. Prostaglandins are involved in the regulation of inflammation, pain, and fever. By inhibiting the production of prostaglandins, 3-(2-Thienyl)propanoic acid reduces inflammation, pain, and fever. |
| Biological Effects | 3-(2-Thienyl)propanoic acid has been shown to have potential therapeutic effects on cell function and signal transduction. It has been found to inhibit the proliferation of cancer cells and induce apoptosis. Additionally, it has been shown to modulate the activity of ion channels and neurotransmitter receptors, which are involved in the regulation of neuronal function. However, 3-(2-Thienyl)propanoic acid also has potential toxic effects, including hepatotoxicity and nephrotoxicity. These toxic effects are dose-dependent and can be mitigated by proper dosing and monitoring. |
| Applications | In medical research, 3-(2-Thienyl)propanoic acid has been studied for its role in drug development. It has been found to have potential therapeutic effects on various diseases, including cancer, inflammation, and pain. Clinical trials have shown promising results in the treatment of rheumatoid arthritis and osteoarthritis. However, further studies are needed to determine the safety and efficacy of this compound in humans. In environmental research, 3-(2-Thienyl)propanoic acid has been studied for its effects on ecosystems and its role in pollution management. It has been found to have potential applications in the treatment of contaminated soil and water. In industrial research, 3-(2-Thienyl)propanoic acid has been used in manufacturing processes to improve product quality and efficiency. Health and safety considerations are important in the use of this compound in industrial settings. |
| Future Perspectives and Challenges | The use and study of 3-(2-Thienyl)propanoic acid face several limitations and challenges. One of the challenges is the potential toxic effects of this compound, which require proper dosing and monitoring. Another challenge is the need for further studies to determine the safety and efficacy of this compound in humans. Future trends and prospects in the application of 3-(2-Thienyl)propanoic acid in scientific research include the development of new drugs and the exploration of its potential environmental applications. Possible solutions and improvements include the development of safer and more efficient synthesis methods and the optimization of dosing and monitoring protocols. In conclusion, 3-(2-Thienyl)propanoic acid is a chemical compound with potential therapeutic and environmental applications. The methods of synthesis, chemical structure, biological activity, biological effects, applications, future perspectives, and challenges associated with this compound have been discussed in this paper. Further studies are needed to determine the safety and efficacy of this compound in humans and to explore its potential applications in scientific research. |
| Pictograms | Corrosive |
| SMILES | C1=CSC(=C1)CCC(=O)O |
| Synonyms | 3-(Thiophen-2-yl)propionic Acid; β-(2-Thienyl)propionic Acid; 2-Thiophenepropionic Acid |
| PubChem Compound | 3-(2-Thienyl)propanoic acid |
| Last Modified | May 30 2023 |