3-(2-Thienyl)acrylic acid
Inhibitors/Agonists
3-(2-Thienyl)acrylic acid is a chemical compound that belongs to the class of thienylacrylic acids. It is a yellow crystalline solid that is soluble in water and organic solvents. This compound has gained significant attention in scientific research due to its potential biological and industrial applications.
154.19 g/mol
154.19 g/mol
Formulation:
154.19 g/mol
Source:
Usage:
3-(2-Thienyl)acrylic acid
The product is for non-human research only. Not for therapeutic or veterinary use.
Catalog Number: BT-313455
CAS Number: 15690-25-2
Molecular Formula: C7H6O2S
Molecular Weight: 154.19 g/mol
Purity: ≥ 97%
Inventory: In Stock
| Size | SKU | Price | |
|---|---|---|---|
| 250mg | bt-313455-250mg | $298.62 | |
| 1g | bt-313455-1g | $567.23 | |
| 5g | bt-313455-5g | $1,801.54 | |
| 10g | bt-313455-10g | $3,085.69 | |
| 25g | bt-313455-25g | $4,071.08 | |
| 50g | bt-313455-50g | $8,042.62 | |
| 100g | bt-313455-100g | $16,523.38 | |
| 250g | bt-313455-250g | $31,842.31 |
| CAS Number | 15690-25-2 |
|---|---|
| Product Name | 3-(2-Thienyl)acrylic acid |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.19 g/mol |
| InChI | InChI=1S/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/b4-3+ |
| InChI Key | KKMZQOIASVGJQE-ONEGZZNKSA-N |
| Isomeric SMILES | C1=CSC(=C1)/C=C/C(=O)O |
| IUPAC Name | (E)-3-thiophen-2-ylprop-2-enoic acid |
| Canonical SMILES | C1=CSC(=C1)C=CC(=O)O |
| Description | 3-(2-Thienyl)acrylic acid is a chemical compound that belongs to the class of thienylacrylic acids. It is a yellow crystalline solid that is soluble in water and organic solvents. This compound has gained significant attention in scientific research due to its potential biological and industrial applications. |
| Method of Synthesis or Extraction | There are several methods for synthesizing 3-(2-Thienyl)acrylic acid, including the Knoevenagel condensation reaction, the Wittig reaction, and the Heck reaction. The Knoevenagel condensation reaction involves the reaction of 2-thiophenecarboxaldehyde with malonic acid in the presence of a base catalyst. The Wittig reaction involves the reaction of 2-thiophenecarboxaldehyde with a phosphonium ylide to form the corresponding olefin. The Heck reaction involves the reaction of 2-thiophenecarboxaldehyde with an alkene in the presence of a palladium catalyst. The efficiency and yield of each method vary depending on the reaction conditions and the starting materials used. The Knoevenagel condensation reaction is the most commonly used method for synthesizing 3-(2-Thienyl)acrylic acid, with a yield of up to 80%. However, this method requires a high temperature and long reaction time, which can lead to environmental and safety concerns. |
| Chemical Structure and Biological Activity | The chemical structure of 3-(2-Thienyl)acrylic acid consists of a thiophene ring attached to an acrylic acid moiety. This compound has been shown to exhibit various biological activities, including anti-inflammatory, antioxidant, and anticancer properties. The mechanism of action of 3-(2-Thienyl)acrylic acid involves the inhibition of various enzymes and signaling pathways involved in cell proliferation and inflammation. This compound has been found to target several biological molecules, including cyclooxygenase-2, nuclear factor-kappa B, and mitogen-activated protein kinases. The bioactivity and potency of 3-(2-Thienyl)acrylic acid depend on the concentration, duration of exposure, and the type of cells or tissues used in the experiments. |
| Biological Effects | The biological effects of 3-(2-Thienyl)acrylic acid on cell function and signal transduction have been extensively studied. This compound has been shown to inhibit the proliferation and migration of cancer cells, induce apoptosis, and reduce the production of pro-inflammatory cytokines. However, the potential therapeutic and toxic effects of 3-(2-Thienyl)acrylic acid in humans are still unclear. Further studies are needed to determine the safety and efficacy of this compound in clinical settings. |
| Applications | 3-(2-Thienyl)acrylic acid has potential applications in medical, environmental, and industrial research. In medical research, this compound has been investigated for its role in drug development, particularly in the treatment of cancer and inflammatory diseases. Clinical trials have shown promising results in the use of 3-(2-Thienyl)acrylic acid as a therapeutic agent. However, more research is needed to determine its safety and efficacy in humans. In environmental research, 3-(2-Thienyl)acrylic acid has been studied for its effects on ecosystems and its role in pollution management. This compound has been found to have low toxicity to aquatic organisms and may have potential applications in wastewater treatment. In industrial research, 3-(2-Thienyl)acrylic acid has been used in manufacturing processes to improve product quality and efficiency. However, health and safety considerations must be taken into account when handling this compound. |
| Future Perspectives and Challenges | Despite the potential applications of 3-(2-Thienyl)acrylic acid, there are still limitations in its use and study. One of the main challenges is the lack of understanding of its mechanism of action and its potential toxic effects in humans. Future research should focus on elucidating the molecular targets and pathways involved in the biological activity of this compound. Another challenge is the development of more efficient and environmentally friendly methods for synthesizing 3-(2-Thienyl)acrylic acid. Possible solutions include the use of green chemistry principles and the development of new catalysts and reaction conditions. In the future, 3-(2-Thienyl)acrylic acid may have potential applications in various fields, including medicine, environmental science, and industry. |
| Other CAS Number | 1124-65-8 15690-25-2 |
| Pictograms | Irritant |
| SMILES | C1=CSC(=C1)C=CC(=O)O |
| Synonyms | (E)-3-(Thiophen-2-yl)-2-propenoic Acid; (E)-3-(Thiophen-2-yl)acrylic Acid; trans-3-Thiopheneacrylic Acid; (E)-2-Thiopheneacrylic Acid; (E)-3-(2-Thienyl)-2-propenoic Acid; |
| PubChem Compound | 3-(2-Thienyl)acrylic acid |
| Last Modified | May 29 2023 |