N-tert-Butyl-2-thiophenesulfonamide
Inhibitors/Agonists
N-tert-Butyl-2-thiophenesulfonamide is a chemical compound that has gained significant attention in the scientific community due to its potential therapeutic and environmental applications. This paper aims to provide a comprehensive review of the synthesis, chemical structure, biological activity, and applications of N-tert-Butyl-2-thiophenesulfonamide.
219.3 g/mol
219.3 g/mol
Formulation:
219.3 g/mol
Source:
Usage:
N-tert-Butyl-2-thiophenesulfonamide
The product is for non-human research only. Not for therapeutic or veterinary use.
Catalog Number: BT-291595
CAS Number: 100342-30-1
Molecular Formula: C8H13NO2S2
Molecular Weight: 219.3 g/mol
Purity: ≥ 95%
Inventory: In Stock
| Size | SKU | Price | |
|---|---|---|---|
| 1g | bt-291595-1g | $294.15 | |
| 5g | bt-291595-5g | $1,002.92 | |
| 10g | bt-291595-10g | $1,882.00 | |
| 25g | bt-291595-25g | $3,905.08 | |
| 100g | bt-291595-100g | $13,608.77 |
| CAS Number | 100342-30-1 |
|---|---|
| Product Name | N-tert-Butyl-2-thiophenesulfonamide |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.3 g/mol |
| InChI | InChI=1S/C8H13NO2S2/c1-8(2,3)9-13(10,11)7-5-4-6-12-7/h4-6,9H,1-3H3 |
| InChI Key | CLKMBGGZGFULOO-UHFFFAOYSA-N |
| IUPAC Name | N-tert-butylthiophene-2-sulfonamide |
| Canonical SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CS1 |
| Description | N-tert-Butyl-2-thiophenesulfonamide is a chemical compound that has gained significant attention in the scientific community due to its potential therapeutic and environmental applications. This paper aims to provide a comprehensive review of the synthesis, chemical structure, biological activity, and applications of N-tert-Butyl-2-thiophenesulfonamide. |
| Method of Synthesis or Extraction | N-tert-Butyl-2-thiophenesulfonamide can be synthesized using various methods, including the reaction of tert-butylamine with 2-chlorothiophene-3-sulfonyl chloride or the reaction of tert-butylamine with 2-thiophenesulfonyl chloride. The efficiency and yield of each method depend on the reaction conditions, such as temperature, solvent, and catalyst. However, the synthesis of N-tert-Butyl-2-thiophenesulfonamide requires careful consideration of environmental and safety considerations, as the reaction involves the use of hazardous chemicals. |
| Chemical Structure and Biological Activity | N-tert-Butyl-2-thiophenesulfonamide has a unique chemical structure that consists of a thiophene ring and a sulfonamide group. The compound has shown promising biological activity, particularly in the field of cancer research. N-tert-Butyl-2-thiophenesulfonamide has been found to inhibit the growth of cancer cells by targeting specific biological pathways. The compound has also shown potential in the treatment of other diseases, such as diabetes and inflammation. |
| Biological Effects | N-tert-Butyl-2-thiophenesulfonamide has been shown to affect cell function and signal transduction by inhibiting specific enzymes and proteins. The compound has also been found to have potential therapeutic effects, such as reducing tumor growth and inflammation. However, N-tert-Butyl-2-thiophenesulfonamide may also have toxic effects, and further research is needed to determine its safety and potential side effects. |
| Applications | N-tert-Butyl-2-thiophenesulfonamide has various applications in medical, environmental, and industrial research. In medical research, the compound has been studied for its potential role in drug development and has shown promising results in preclinical studies. In environmental research, N-tert-Butyl-2-thiophenesulfonamide has been found to have effects on ecosystems and may have a role in pollution management. In industrial research, the compound has been used in manufacturing processes to improve product quality and efficiency, but health and safety considerations must be taken into account. |
| Future Perspectives and Challenges | Despite the promising potential of N-tert-Butyl-2-thiophenesulfonamide, there are still limitations in its use and study. Further research is needed to determine its safety and potential side effects, as well as its efficacy in clinical trials. Possible solutions and improvements include the development of more efficient and environmentally friendly synthesis methods and the identification of new biological targets. Future trends and prospects in the application of N-tert-Butyl-2-thiophenesulfonamide in scientific research are promising, but challenges must be overcome to fully realize its potential. In conclusion, N-tert-Butyl-2-thiophenesulfonamide is a compound with significant potential in various fields of research. Its unique chemical structure and biological activity make it a promising candidate for drug development and environmental applications. However, further research is needed to fully understand its safety and potential side effects, as well as its efficacy in clinical trials. |
| Pictograms | Irritant |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CS1 |
| PubChem Compound | N-tert-Butyl-2-thiophenesulfonamide |
| Last Modified | May 29 2023 |